C20H29FN2O3 — CID 110616550
1-(4-fluorophenyl)-4-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]butane-1,4-dione (PubChem CID 110616550) has the molecular formula C20H29FN2O3 and a molecular weight of 364.46 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]butane-1,4-dione.
| Compound Name | 1-(4-fluorophenyl)-4-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]butane-1,4-dione |
|---|---|
| PubChem CID | 110616550 |
| Molecular Formula | C20H29FN2O3 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]butane-1,4-dione |
| SMILES | COCCCN1C(C)CN(C(=O)CCC(=O)c2ccc(F)cc2)CC1C |
| InChI | InChI=1S/C20H29FN2O3/c1-15-13-22(14-16(2)23(15)11-4-12-26-3)20(25)10-9-19(24)17-5-7-18(21)8-6-17/h5-8,15-16H,4,9-14H2,1-3H3 |
| InChIKey | NEUZAEGWAZZVSJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|