C15H18FNO3 — CID 110310053
1-(4-fluorophenyl)-4-(2-methylmorpholin-4-yl)butane-1,4-dione (PubChem CID 110310053) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(2-methylmorpholin-4-yl)butane-1,4-dione.
| Compound Name | 1-(4-fluorophenyl)-4-(2-methylmorpholin-4-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 110310053 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(2-methylmorpholin-4-yl)butane-1,4-dione |
| SMILES | CC1CN(C(=O)CCC(=O)c2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C15H18FNO3/c1-11-10-17(8-9-20-11)15(19)7-6-14(18)12-2-4-13(16)5-3-12/h2-5,11H,6-10H2,1H3 |
| InChIKey | WIJDPRNMUBHEKH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |