C17H21FN2O2 — CID 91764252
1-[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-4-(4-fluorophenyl)butane-1,4-dione (PubChem CID 91764252) has the molecular formula C17H21FN2O2 and a molecular weight of 304.36 g/mol. Its IUPAC name is 1-[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-4-(4-fluorophenyl)butane-1,4-dione.
| Compound Name | 1-[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-4-(4-fluorophenyl)butane-1,4-dione |
|---|---|
| PubChem CID | 91764252 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 1-[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-4-(4-fluorophenyl)butane-1,4-dione |
| SMILES | CN1CC[C@H]2CN(C(=O)CCC(=O)c3ccc(F)cc3)C[C@H]21 |
| InChI | InChI=1S/C17H21FN2O2/c1-19-9-8-13-10-20(11-15(13)19)17(22)7-6-16(21)12-2-4-14(18)5-3-12/h2-5,13,15H,6-11H2,1H3/t13-,15+/m0/s1 |
| InChIKey | UVCGSWOBWQLNNF-DZGCQCFKSA-N |
| XLogP | 1.95 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |