C20H24ClN3O — CID 70781903
1-[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-3-[5-(4-chlorophenyl)-1H-pyrrol-2-yl]propan-1-one (PubChem CID 70781903) has the molecular formula C20H24ClN3O and a molecular weight of 357.88 g/mol. Its IUPAC name is 1-[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-3-[5-(4-chlorophenyl)-1H-pyrrol-2-yl]propan-1-one.
| Compound Name | 1-[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-3-[5-(4-chlorophenyl)-1H-pyrrol-2-yl]propan-1-one |
|---|---|
| PubChem CID | 70781903 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 1-[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-3-[5-(4-chlorophenyl)-1H-pyrrol-2-yl]propan-1-one |
| SMILES | CN1CC[C@H]2CN(C(=O)CCc3ccc(-c4ccc(Cl)cc4)[nH]3)C[C@H]21 |
| InChI | InChI=1S/C20H24ClN3O/c1-23-11-10-15-12-24(13-19(15)23)20(25)9-7-17-6-8-18(22-17)14-2-4-16(21)5-3-14/h2-6,8,15,19,22H,7,9-13H2,1H3/t15-,19+/m0/s1 |
| InChIKey | VQZXJVFZZCQZAD-HNAYVOBHSA-N |
| XLogP | 3.43 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |