C18H26N2O4 — CID 133129821
1-[(3aR,6aR)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-2-(3,4,5-trimethoxyphenyl)ethanone (PubChem CID 133129821) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-[(3aR,6aR)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-2-(3,4,5-trimethoxyphenyl)ethanone.
| Compound Name | 1-[(3aR,6aR)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-2-(3,4,5-trimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 133129821 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1-[(3aR,6aR)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-2-(3,4,5-trimethoxyphenyl)ethanone |
| SMILES | COc1cc(CC(=O)N2C[C@H]3CCN(C)[C@H]3C2)cc(OC)c1OC |
| InChI | InChI=1S/C18H26N2O4/c1-19-6-5-13-10-20(11-14(13)19)17(21)9-12-7-15(22-2)18(24-4)16(8-12)23-3/h7-8,13-14H,5-6,9-11H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | DYDUHVYHGPDKBF-KGLIPLIRSA-N |
| XLogP | 1.42 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |