C19H29N3O4 — CID 120996197
1-(3-piperazin-1-ylpyrrolidin-1-yl)-2-(3,4,5-trimethoxyphenyl)ethanone (PubChem CID 120996197) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-(3-piperazin-1-ylpyrrolidin-1-yl)-2-(3,4,5-trimethoxyphenyl)ethanone.
| Compound Name | 1-(3-piperazin-1-ylpyrrolidin-1-yl)-2-(3,4,5-trimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 120996197 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 1-(3-piperazin-1-ylpyrrolidin-1-yl)-2-(3,4,5-trimethoxyphenyl)ethanone |
| SMILES | COc1cc(CC(=O)N2CCC(N3CCNCC3)C2)cc(OC)c1OC |
| InChI | InChI=1S/C19H29N3O4/c1-24-16-10-14(11-17(25-2)19(16)26-3)12-18(23)22-7-4-15(13-22)21-8-5-20-6-9-21/h10-11,15,20H,4-9,12-13H2,1-3H3 |
| InChIKey | SYUNYFHQYAUYDE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |