C16H21FN2O4S — CID 155873171
1-[(3aR,6aR)-1-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-2-(3-fluoro-4-methoxyphenyl)ethanone (PubChem CID 155873171) has the molecular formula C16H21FN2O4S and a molecular weight of 356.42 g/mol. Its IUPAC name is 1-[(3aR,6aR)-1-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-2-(3-fluoro-4-methoxyphenyl)ethanone.
| Compound Name | 1-[(3aR,6aR)-1-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-2-(3-fluoro-4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 155873171 |
| Molecular Formula | C16H21FN2O4S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1-[(3aR,6aR)-1-methylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-2-(3-fluoro-4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)N2C[C@H]3CCN(S(C)(=O)=O)[C@H]3C2)cc1F |
| InChI | InChI=1S/C16H21FN2O4S/c1-23-15-4-3-11(7-13(15)17)8-16(20)18-9-12-5-6-19(14(12)10-18)24(2,21)22/h3-4,7,12,14H,5-6,8-10H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | KOWQUTLKXYJTSI-OCCSQVGLSA-N |
| XLogP | 0.87 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |