C22H31FN2O5 — CID 172912091
1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(3-fluoro-4-methoxyphenyl)ethanone;formic acid (PubChem CID 172912091) has the molecular formula C22H31FN2O5 and a molecular weight of 422.50 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(3-fluoro-4-methoxyphenyl)ethanone;formic acid.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(3-fluoro-4-methoxyphenyl)ethanone;formic acid |
|---|---|
| PubChem CID | 172912091 |
| Molecular Formula | C22H31FN2O5 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(3-fluoro-4-methoxyphenyl)ethanone;formic acid |
| SMILES | COc1ccc(CC(=O)N2C[C@H]3C[C@@H](N4CCCC4)[C@H](O)C[C@H]3C2)cc1F.O=CO |
| InChI | InChI=1S/C21H29FN2O3.CH2O2/c1-27-20-5-4-14(8-17(20)22)9-21(26)24-12-15-10-18(23-6-2-3-7-23)19(25)11-16(15)13-24;2-1-3/h4-5,8,15-16,18-19,25H,2-3,6-7,9-13H2,1H3;1H,(H,2,3)/t15-,16+,18-,19-;/m1./s1 |
| InChIKey | YVISARQLQUMDSL-LJBKODRFSA-N |
| XLogP | 1.77 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|