C19H26F2N2O — CID 172655215
(3aR,5R,6R,7aS)-2-[(3,4-difluorophenyl)methyl]-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172655215) has the molecular formula C19H26F2N2O and a molecular weight of 336.43 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-[(3,4-difluorophenyl)methyl]-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-[(3,4-difluorophenyl)methyl]-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172655215 |
| Molecular Formula | C19H26F2N2O |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-[(3,4-difluorophenyl)methyl]-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | O[C@@H]1C[C@H]2CN(Cc3ccc(F)c(F)c3)C[C@H]2C[C@H]1N1CCCC1 |
| InChI | InChI=1S/C19H26F2N2O/c20-16-4-3-13(7-17(16)21)10-22-11-14-8-18(23-5-1-2-6-23)19(24)9-15(14)12-22/h3-4,7,14-15,18-19,24H,1-2,5-6,8-12H2/t14-,15+,18-,19-/m1/s1 |
| InChIKey | JRHAUNMCBXTJNZ-WTLGNFPFSA-N |
| XLogP | 2.63 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |