C14H15F2NO4 — CID 115918627
1-[(3,4-difluorophenyl)methyl]piperidine-3,4-dicarboxylic acid (PubChem CID 115918627) has the molecular formula C14H15F2NO4 and a molecular weight of 299.27 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 115918627 |
| Molecular Formula | C14H15F2NO4 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]piperidine-3,4-dicarboxylic acid |
| SMILES | O=C(O)C1CCN(Cc2ccc(F)c(F)c2)CC1C(=O)O |
| InChI | InChI=1S/C14H15F2NO4/c15-11-2-1-8(5-12(11)16)6-17-4-3-9(13(18)19)10(7-17)14(20)21/h1-2,5,9-10H,3-4,6-7H2,(H,18,19)(H,20,21) |
| InChIKey | FAMCYYYLXVRNPO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |