C14H15BrFNO4 — CID 115918814
1-[(2-bromo-3-fluorophenyl)methyl]piperidine-3,4-dicarboxylic acid (PubChem CID 115918814) has the molecular formula C14H15BrFNO4 and a molecular weight of 360.18 g/mol. Its IUPAC name is 1-[(2-bromo-3-fluorophenyl)methyl]piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-[(2-bromo-3-fluorophenyl)methyl]piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 115918814 |
| Molecular Formula | C14H15BrFNO4 |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 1-[(2-bromo-3-fluorophenyl)methyl]piperidine-3,4-dicarboxylic acid |
| SMILES | O=C(O)C1CCN(Cc2cccc(F)c2Br)CC1C(=O)O |
| InChI | InChI=1S/C14H15BrFNO4/c15-12-8(2-1-3-11(12)16)6-17-5-4-9(13(18)19)10(7-17)14(20)21/h1-3,9-10H,4-7H2,(H,18,19)(H,20,21) |
| InChIKey | APXJEXBDAILYDP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |