C12H14BrNO4S — CID 112568140
1-[(5-bromothiophen-2-yl)methyl]piperidine-3,4-dicarboxylic acid (PubChem CID 112568140) has the molecular formula C12H14BrNO4S and a molecular weight of 348.22 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 112568140 |
| Molecular Formula | C12H14BrNO4S |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]piperidine-3,4-dicarboxylic acid |
| SMILES | O=C(O)C1CCN(Cc2ccc(Br)s2)CC1C(=O)O |
| InChI | InChI=1S/C12H14BrNO4S/c13-10-2-1-7(19-10)5-14-4-3-8(11(15)16)9(6-14)12(17)18/h1-2,8-9H,3-6H2,(H,15,16)(H,17,18) |
| InChIKey | YXWOWOABSKUEHA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |