C15H24BrN2O2S+ — CID 69261350
(2S)-4-[(5-bromothiophen-2-yl)methyl]-1-tert-butyl-2-methylpiperazin-1-ium-1-carboxylic acid (PubChem CID 69261350) has the molecular formula C15H24BrN2O2S+ and a molecular weight of 376.34 g/mol. Its IUPAC name is (2S)-4-[(5-bromothiophen-2-yl)methyl]-1-tert-butyl-2-methylpiperazin-1-ium-1-carboxylic acid.
| Compound Name | (2S)-4-[(5-bromothiophen-2-yl)methyl]-1-tert-butyl-2-methylpiperazin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 69261350 |
| Molecular Formula | C15H24BrN2O2S+ |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | (2S)-4-[(5-bromothiophen-2-yl)methyl]-1-tert-butyl-2-methylpiperazin-1-ium-1-carboxylic acid |
| SMILES | C[C@H]1CN(Cc2ccc(Br)s2)CC[N+]1(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C15H23BrN2O2S/c1-11-9-17(10-12-5-6-13(16)21-12)7-8-18(11,14(19)20)15(2,3)4/h5-6,11H,7-10H2,1-4H3/p+1/t11-,18?/m0/s1 |
| InChIKey | CRKNNDXMPIOFJD-FAQQKDIKSA-O |
| XLogP | 4.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|