C9H12BrNO2S — CID 106672227
1-[(5-bromothiophen-2-yl)methyl]pyrrolidine-3,4-diol (PubChem CID 106672227) has the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106672227 |
| Molecular Formula | C9H12BrNO2S |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]pyrrolidine-3,4-diol |
| SMILES | OC1CN(Cc2ccc(Br)s2)CC1O |
| InChI | InChI=1S/C9H12BrNO2S/c10-9-2-1-6(14-9)3-11-4-7(12)8(13)5-11/h1-2,7-8,12-13H,3-5H2 |
| InChIKey | ZFQXEXXHMGKGOY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |