C11H14BrN2O2S- — CID 86634994
(2S)-4-[(5-bromothiophen-2-yl)methyl]-2-methylpiperazine-1-carboxylate (PubChem CID 86634994) has the molecular formula C11H14BrN2O2S- and a molecular weight of 318.22 g/mol. Its IUPAC name is (2S)-4-[(5-bromothiophen-2-yl)methyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | (2S)-4-[(5-bromothiophen-2-yl)methyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 86634994 |
| Molecular Formula | C11H14BrN2O2S- |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | (2S)-4-[(5-bromothiophen-2-yl)methyl]-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@H]1CN(Cc2ccc(Br)s2)CCN1C(=O)[O-] |
| InChI | InChI=1S/C11H15BrN2O2S/c1-8-6-13(4-5-14(8)11(15)16)7-9-2-3-10(12)17-9/h2-3,8H,4-7H2,1H3,(H,15,16)/p-1/t8-/m0/s1 |
| InChIKey | NWTGWGRNSPTXED-QMMMGPOBSA-M |
| XLogP | 1.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |