C11H16BrNS — CID 115688536
1-[(5-bromothiophen-2-yl)methyl]-3-ethylpyrrolidine (PubChem CID 115688536) has the molecular formula C11H16BrNS and a molecular weight of 274.23 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-3-ethylpyrrolidine.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-3-ethylpyrrolidine |
|---|---|
| PubChem CID | 115688536 |
| Molecular Formula | C11H16BrNS |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-3-ethylpyrrolidine |
| SMILES | CCC1CCN(Cc2ccc(Br)s2)C1 |
| InChI | InChI=1S/C11H16BrNS/c1-2-9-5-6-13(7-9)8-10-3-4-11(12)14-10/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | OAFHXVVLQNRKPA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |