C11H18BrClN2S — CID 119922215
1-[1-[(5-bromothiophen-2-yl)methyl]pyrrolidin-3-yl]-N-methylmethanamine;hydrochloride (PubChem CID 119922215) has the molecular formula C11H18BrClN2S and a molecular weight of 325.70 g/mol. Its IUPAC name is 1-[1-[(5-bromothiophen-2-yl)methyl]pyrrolidin-3-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[1-[(5-bromothiophen-2-yl)methyl]pyrrolidin-3-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 119922215 |
| Molecular Formula | C11H18BrClN2S |
| Molecular Weight | 325.70 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 1-[1-[(5-bromothiophen-2-yl)methyl]pyrrolidin-3-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCC1CCN(Cc2ccc(Br)s2)C1.Cl |
| InChI | InChI=1S/C11H17BrN2S.ClH/c1-13-6-9-4-5-14(7-9)8-10-2-3-11(12)15-10;/h2-3,9,13H,4-8H2,1H3;1H |
| InChIKey | OPKZPMWYYXIVFT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.70 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |