C11H17BrN2O — CID 63263347
1-[1-[(5-bromofuran-2-yl)methyl]pyrrolidin-3-yl]-N-methylmethanamine (PubChem CID 63263347) has the molecular formula C11H17BrN2O and a molecular weight of 273.17 g/mol. Its IUPAC name is 1-[1-[(5-bromofuran-2-yl)methyl]pyrrolidin-3-yl]-N-methylmethanamine.
| Compound Name | 1-[1-[(5-bromofuran-2-yl)methyl]pyrrolidin-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 63263347 |
| Molecular Formula | C11H17BrN2O |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1-[1-[(5-bromofuran-2-yl)methyl]pyrrolidin-3-yl]-N-methylmethanamine |
| SMILES | CNCC1CCN(Cc2ccc(Br)o2)C1 |
| InChI | InChI=1S/C11H17BrN2O/c1-13-6-9-4-5-14(7-9)8-10-2-3-11(12)15-10/h2-3,9,13H,4-8H2,1H3 |
| InChIKey | VNAGHDOVCUZYRO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |