C19H19F2NO — CID 134116002
[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-phenylmethanone (PubChem CID 134116002) has the molecular formula C19H19F2NO and a molecular weight of 315.36 g/mol. Its IUPAC name is [1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-phenylmethanone.
| Compound Name | [1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 134116002 |
| Molecular Formula | C19H19F2NO |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | [1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1CCN(Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H19F2NO/c20-17-7-6-14(12-18(17)21)13-22-10-8-16(9-11-22)19(23)15-4-2-1-3-5-15/h1-7,12,16H,8-11,13H2 |
| InChIKey | PCZRZVKPNBWAPY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |