C19H23Cl2F2N3O — CID 119857402
3-amino-N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]benzamide;dihydrochloride (PubChem CID 119857402) has the molecular formula C19H23Cl2F2N3O and a molecular weight of 418.32 g/mol. Its IUPAC name is 3-amino-N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]benzamide;dihydrochloride.
| Compound Name | 3-amino-N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119857402 |
| Molecular Formula | C19H23Cl2F2N3O |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 3-amino-N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]benzamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1cccc(C(=O)NC2CCN(Cc3ccc(F)c(F)c3)CC2)c1 |
| InChI | InChI=1S/C19H21F2N3O.2ClH/c20-17-5-4-13(10-18(17)21)12-24-8-6-16(7-9-24)23-19(25)14-2-1-3-15(22)11-14;;/h1-5,10-11,16H,6-9,12,22H2,(H,23,25);2*1H |
| InChIKey | HYSGDNBGYLOPTG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|