C19H21F2N3O — CID 119946714
2-amino-N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]benzamide (PubChem CID 119946714) has the molecular formula C19H21F2N3O and a molecular weight of 345.39 g/mol. Its IUPAC name is 2-amino-N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]benzamide.
| Compound Name | 2-amino-N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 119946714 |
| Molecular Formula | C19H21F2N3O |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-amino-N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]benzamide |
| SMILES | Nc1ccccc1C(=O)NC1CCN(Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H21F2N3O/c20-16-6-5-13(11-17(16)21)12-24-9-7-14(8-10-24)23-19(25)15-3-1-2-4-18(15)22/h1-6,11,14H,7-10,12,22H2,(H,23,25) |
| InChIKey | ZIHOBEBVFQJTNR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|