C19H18Cl2F2N2O — CID 51239211
2-chloro-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-4,5-difluorobenzamide (PubChem CID 51239211) has the molecular formula C19H18Cl2F2N2O and a molecular weight of 399.27 g/mol. Its IUPAC name is 2-chloro-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 51239211 |
| Molecular Formula | C19H18Cl2F2N2O |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-chloro-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-4,5-difluorobenzamide |
| SMILES | O=C(NC1CCN(Cc2ccc(Cl)cc2)CC1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C19H18Cl2F2N2O/c20-13-3-1-12(2-4-13)11-25-7-5-14(6-8-25)24-19(26)15-9-17(22)18(23)10-16(15)21/h1-4,9-10,14H,5-8,11H2,(H,24,26) |
| InChIKey | WYXHCDVYLTZYFX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|