C19H19Cl2FN2O — CID 10134420
N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-4-fluorobenzamide (PubChem CID 10134420) has the molecular formula C19H19Cl2FN2O and a molecular weight of 381.28 g/mol. Its IUPAC name is N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-4-fluorobenzamide.
| Compound Name | N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 10134420 |
| Molecular Formula | C19H19Cl2FN2O |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-[1-[(3,4-dichlorophenyl)methyl]piperidin-4-yl]-4-fluorobenzamide |
| SMILES | O=C(NC1CCN(Cc2ccc(Cl)c(Cl)c2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19Cl2FN2O/c20-17-6-1-13(11-18(17)21)12-24-9-7-16(8-10-24)23-19(25)14-2-4-15(22)5-3-14/h1-6,11,16H,7-10,12H2,(H,23,25) |
| InChIKey | HKQPWRJGKXBDSG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |