C23H25FN4OS — CID 55959686
N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-4-(2-methylsulfanylimidazol-1-yl)benzamide (PubChem CID 55959686) has the molecular formula C23H25FN4OS and a molecular weight of 424.55 g/mol. Its IUPAC name is N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-4-(2-methylsulfanylimidazol-1-yl)benzamide.
| Compound Name | N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-4-(2-methylsulfanylimidazol-1-yl)benzamide |
|---|---|
| PubChem CID | 55959686 |
| Molecular Formula | C23H25FN4OS |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-4-(2-methylsulfanylimidazol-1-yl)benzamide |
| SMILES | CSc1nccn1-c1ccc(C(=O)NC2CCN(Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H25FN4OS/c1-30-23-25-12-15-28(23)21-8-4-18(5-9-21)22(29)26-20-10-13-27(14-11-20)16-17-2-6-19(24)7-3-17/h2-9,12,15,20H,10-11,13-14,16H2,1H3,(H,26,29) |
| InChIKey | BJSMVJLBGIPELO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |