C21H23F2N3O2 — CID 166296875
2,4-difluoro-N-[1-[[4-(methylcarbamoyl)phenyl]methyl]piperidin-4-yl]benzamide (PubChem CID 166296875) has the molecular formula C21H23F2N3O2 and a molecular weight of 387.43 g/mol. Its IUPAC name is 2,4-difluoro-N-[1-[[4-(methylcarbamoyl)phenyl]methyl]piperidin-4-yl]benzamide.
| Compound Name | 2,4-difluoro-N-[1-[[4-(methylcarbamoyl)phenyl]methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 166296875 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2,4-difluoro-N-[1-[[4-(methylcarbamoyl)phenyl]methyl]piperidin-4-yl]benzamide |
| SMILES | CNC(=O)c1ccc(CN2CCC(NC(=O)c3ccc(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C21H23F2N3O2/c1-24-20(27)15-4-2-14(3-5-15)13-26-10-8-17(9-11-26)25-21(28)18-7-6-16(22)12-19(18)23/h2-7,12,17H,8-11,13H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | USRRARWXSRGHBT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |