C14H15F2N3O — CID 63625204
N-[1-(cyanomethyl)piperidin-4-yl]-2,4-difluorobenzamide (PubChem CID 63625204) has the molecular formula C14H15F2N3O and a molecular weight of 279.29 g/mol. Its IUPAC name is N-[1-(cyanomethyl)piperidin-4-yl]-2,4-difluorobenzamide.
| Compound Name | N-[1-(cyanomethyl)piperidin-4-yl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 63625204 |
| Molecular Formula | C14H15F2N3O |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[1-(cyanomethyl)piperidin-4-yl]-2,4-difluorobenzamide |
| SMILES | N#CCN1CCC(NC(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C14H15F2N3O/c15-10-1-2-12(13(16)9-10)14(20)18-11-3-6-19(7-4-11)8-5-17/h1-2,9,11H,3-4,6-8H2,(H,18,20) |
| InChIKey | TZECRLNKAIRTSQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|