About N-[1-(cyanomethyl)piperidin-4-yl]-2,6-dihydroxybenzamide
N-[1-(cyanomethyl)piperidin-4-yl]-2,6-dihydroxybenzamide (PubChem CID 103890464) has the molecular formula C14H17N3O3
and a molecular weight of 275.31 g/mol. Its IUPAC name is N-[1-(cyanomethyl)piperidin-4-yl]-2,6-dihydroxybenzamide.
Molecular Properties
| Compound Name | N-[1-(cyanomethyl)piperidin-4-yl]-2,6-dihydroxybenzamide |
| PubChem CID | 103890464 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-[1-(cyanomethyl)piperidin-4-yl]-2,6-dihydroxybenzamide |
| SMILES | N#CCN1CCC(NC(=O)c2c(O)cccc2O)CC1 |
| InChI | InChI=1S/C14H17N3O3/c15-6-9-17-7-4-10(5-8-17)16-14(20)13-11(18)2-1-3-12(13)19/h1-3,10,18-19H,4-5,7-9H2,(H,16,20) |
| InChIKey | RHYSYZJGQXJZCT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(cyanomethyl)piperidin-4-yl]-2,6-dihydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(cyanomethyl)piperidin-4-yl]-2,6-dihydroxybenzamide?
The IUPAC name of N-[1-(cyanomethyl)piperidin-4-yl]-2,6-dihydroxybenzamide (CID 103890464) is N-[1-(cyanomethyl)piperidin-4-yl]-2,6-dihydroxybenzamide.
What is the SMILES notation for N-[1-(cyanomethyl)piperidin-4-yl]-2,6-dihydroxybenzamide?
The canonical SMILES for N-[1-(cyanomethyl)piperidin-4-yl]-2,6-dihydroxybenzamide is N#CCN1CCC(NC(=O)c2c(O)cccc2O)CC1.
What is the InChIKey of N-[1-(cyanomethyl)piperidin-4-yl]-2,6-dihydroxybenzamide?
The InChIKey is RHYSYZJGQXJZCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3/c15-6-9-17-7-4-10(5-8-17)16-14(20)13-11(18)2-1-3-12(13)19/h1-3,10,18-19H,4-5,7-9H2,(H,16,20).
What are the key properties of N-[1-(cyanomethyl)piperidin-4-yl]-2,6-dihydroxybenzamide?
N-[1-(cyanomethyl)piperidin-4-yl]-2,6-dihydroxybenzamide has a molecular weight of 275.31 g/mol, XLogP of 0.82, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(cyanomethyl)piperidin-4-yl]-2,6-dihydroxybenzamide is sourced from PubChem (CID 103890464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).