C14H14ClF2N3O — CID 82772011
4-chloro-N-[1-(cyanomethyl)piperidin-4-yl]-2,5-difluorobenzamide (PubChem CID 82772011) has the molecular formula C14H14ClF2N3O and a molecular weight of 313.74 g/mol. Its IUPAC name is 4-chloro-N-[1-(cyanomethyl)piperidin-4-yl]-2,5-difluorobenzamide.
| Compound Name | 4-chloro-N-[1-(cyanomethyl)piperidin-4-yl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 82772011 |
| Molecular Formula | C14H14ClF2N3O |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 4-chloro-N-[1-(cyanomethyl)piperidin-4-yl]-2,5-difluorobenzamide |
| SMILES | N#CCN1CCC(NC(=O)c2cc(F)c(Cl)cc2F)CC1 |
| InChI | InChI=1S/C14H14ClF2N3O/c15-11-8-12(16)10(7-13(11)17)14(21)19-9-1-4-20(5-2-9)6-3-18/h7-9H,1-2,4-6H2,(H,19,21) |
| InChIKey | YKPIDNJZJZQPAA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|