C11H11F2NO — CID 70247338
N-cyclobutyl-2,4-difluorobenzamide (PubChem CID 70247338) has the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. Its IUPAC name is N-cyclobutyl-2,4-difluorobenzamide.
| Compound Name | N-cyclobutyl-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 70247338 |
| Molecular Formula | C11H11F2NO |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | N-cyclobutyl-2,4-difluorobenzamide |
| SMILES | O=C(NC1CCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H11F2NO/c12-7-4-5-9(10(13)6-7)11(15)14-8-2-1-3-8/h4-6,8H,1-3H2,(H,14,15) |
| InChIKey | HXCPMEJIJUJRRO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |