C16H20F2N2O2 — CID 17487252
N-[4-(cyclopentylamino)-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 17487252) has the molecular formula C16H20F2N2O2 and a molecular weight of 310.34 g/mol. Its IUPAC name is N-[4-(cyclopentylamino)-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-(cyclopentylamino)-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 17487252 |
| Molecular Formula | C16H20F2N2O2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N-[4-(cyclopentylamino)-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)NC1CCCC1 |
| InChI | InChI=1S/C16H20F2N2O2/c17-11-7-8-13(14(18)10-11)16(22)19-9-3-6-15(21)20-12-4-1-2-5-12/h7-8,10,12H,1-6,9H2,(H,19,22)(H,20,21) |
| InChIKey | ONZVVYZEEFEGRB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|