C16H22ClF2N3O2 — CID 119427082
2,4-difluoro-N-[4-oxo-4-(piperidin-3-ylamino)butyl]benzamide;hydrochloride (PubChem CID 119427082) has the molecular formula C16H22ClF2N3O2 and a molecular weight of 361.82 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-oxo-4-(piperidin-3-ylamino)butyl]benzamide;hydrochloride.
| Compound Name | 2,4-difluoro-N-[4-oxo-4-(piperidin-3-ylamino)butyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119427082 |
| Molecular Formula | C16H22ClF2N3O2 |
| Molecular Weight | 361.82 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 2,4-difluoro-N-[4-oxo-4-(piperidin-3-ylamino)butyl]benzamide;hydrochloride |
| SMILES | Cl.O=C(CCCNC(=O)c1ccc(F)cc1F)NC1CCCNC1 |
| InChI | InChI=1S/C16H21F2N3O2.ClH/c17-11-5-6-13(14(18)9-11)16(23)20-8-2-4-15(22)21-12-3-1-7-19-10-12;/h5-6,9,12,19H,1-4,7-8,10H2,(H,20,23)(H,21,22);1H |
| InChIKey | XJWCEXIKXHZAEC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.82 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|