C19H27F2N3O2 — CID 119590822
N-[4-[(2-amino-1-cyclohexylethyl)amino]-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 119590822) has the molecular formula C19H27F2N3O2 and a molecular weight of 367.44 g/mol. Its IUPAC name is N-[4-[(2-amino-1-cyclohexylethyl)amino]-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[(2-amino-1-cyclohexylethyl)amino]-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 119590822 |
| Molecular Formula | C19H27F2N3O2 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | N-[4-[(2-amino-1-cyclohexylethyl)amino]-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | NCC(NC(=O)CCCNC(=O)c1ccc(F)cc1F)C1CCCCC1 |
| InChI | InChI=1S/C19H27F2N3O2/c20-14-8-9-15(16(21)11-14)19(26)23-10-4-7-18(25)24-17(12-22)13-5-2-1-3-6-13/h8-9,11,13,17H,1-7,10,12,22H2,(H,23,26)(H,24,25) |
| InChIKey | ARIJEWRIEJRZJW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|