C15H19F3N2O — CID 81487271
N-(2-amino-1-cyclohexylethyl)-2,4,6-trifluorobenzamide (PubChem CID 81487271) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2,4,6-trifluorobenzamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2,4,6-trifluorobenzamide |
|---|---|
| PubChem CID | 81487271 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2,4,6-trifluorobenzamide |
| SMILES | NCC(NC(=O)c1c(F)cc(F)cc1F)C1CCCCC1 |
| InChI | InChI=1S/C15H19F3N2O/c16-10-6-11(17)14(12(18)7-10)15(21)20-13(8-19)9-4-2-1-3-5-9/h6-7,9,13H,1-5,8,19H2,(H,20,21) |
| InChIKey | RUDUGVKRJGMZFC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |