C15H21ClFIN2O — CID 119592223
N-(2-amino-1-cyclohexylethyl)-2-fluoro-6-iodobenzamide;hydrochloride (PubChem CID 119592223) has the molecular formula C15H21ClFIN2O and a molecular weight of 426.70 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2-fluoro-6-iodobenzamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2-fluoro-6-iodobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119592223 |
| Molecular Formula | C15H21ClFIN2O |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2-fluoro-6-iodobenzamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)c1c(F)cccc1I)C1CCCCC1 |
| InChI | InChI=1S/C15H20FIN2O.ClH/c16-11-7-4-8-12(17)14(11)15(20)19-13(9-18)10-5-2-1-3-6-10;/h4,7-8,10,13H,1-3,5-6,9,18H2,(H,19,20);1H |
| InChIKey | XWVPGTMYVAAUPT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|