C15H22FN3O — CID 115309592
2-[(2-amino-1-cyclohexylethyl)amino]-6-fluorobenzamide (PubChem CID 115309592) has the molecular formula C15H22FN3O and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-[(2-amino-1-cyclohexylethyl)amino]-6-fluorobenzamide.
| Compound Name | 2-[(2-amino-1-cyclohexylethyl)amino]-6-fluorobenzamide |
|---|---|
| PubChem CID | 115309592 |
| Molecular Formula | C15H22FN3O |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 2-[(2-amino-1-cyclohexylethyl)amino]-6-fluorobenzamide |
| SMILES | NCC(Nc1cccc(F)c1C(N)=O)C1CCCCC1 |
| InChI | InChI=1S/C15H22FN3O/c16-11-7-4-8-12(14(11)15(18)20)19-13(9-17)10-5-2-1-3-6-10/h4,7-8,10,13,19H,1-3,5-6,9,17H2,(H2,18,20) |
| InChIKey | ZQFVBSNECBMDII-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |