C12H18FN3O — CID 79522229
2-(1-aminopentan-2-ylamino)-6-fluorobenzamide (PubChem CID 79522229) has the molecular formula C12H18FN3O and a molecular weight of 239.29 g/mol. Its IUPAC name is 2-(1-aminopentan-2-ylamino)-6-fluorobenzamide.
| Compound Name | 2-(1-aminopentan-2-ylamino)-6-fluorobenzamide |
|---|---|
| PubChem CID | 79522229 |
| Molecular Formula | C12H18FN3O |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-(1-aminopentan-2-ylamino)-6-fluorobenzamide |
| SMILES | CCCC(CN)Nc1cccc(F)c1C(N)=O |
| InChI | InChI=1S/C12H18FN3O/c1-2-4-8(7-14)16-10-6-3-5-9(13)11(10)12(15)17/h3,5-6,8,16H,2,4,7,14H2,1H3,(H2,15,17) |
| InChIKey | UCVCGFLSWKJUNQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |