C11H16F2N2O2S — CID 65192915
N-(1-aminopentan-2-yl)-2,6-difluorobenzenesulfonamide (PubChem CID 65192915) has the molecular formula C11H16F2N2O2S and a molecular weight of 278.32 g/mol. Its IUPAC name is N-(1-aminopentan-2-yl)-2,6-difluorobenzenesulfonamide.
| Compound Name | N-(1-aminopentan-2-yl)-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 65192915 |
| Molecular Formula | C11H16F2N2O2S |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-(1-aminopentan-2-yl)-2,6-difluorobenzenesulfonamide |
| SMILES | CCCC(CN)NS(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C11H16F2N2O2S/c1-2-4-8(7-14)15-18(16,17)11-9(12)5-3-6-10(11)13/h3,5-6,8,15H,2,4,7,14H2,1H3 |
| InChIKey | UYRFQWVHLVEKIU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |