C13H18FN3O2S — CID 80696719
N-(1-aminohexan-2-yl)-2-cyano-3-fluorobenzenesulfonamide (PubChem CID 80696719) has the molecular formula C13H18FN3O2S and a molecular weight of 299.37 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-cyano-3-fluorobenzenesulfonamide.
| Compound Name | N-(1-aminohexan-2-yl)-2-cyano-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 80696719 |
| Molecular Formula | C13H18FN3O2S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-cyano-3-fluorobenzenesulfonamide |
| SMILES | CCCCC(CN)NS(=O)(=O)c1cccc(F)c1C#N |
| InChI | InChI=1S/C13H18FN3O2S/c1-2-3-5-10(8-15)17-20(18,19)13-7-4-6-12(14)11(13)9-16/h4,6-7,10,17H,2-3,5,8,15H2,1H3 |
| InChIKey | QQVUWOWKXCATMU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |