C13H19ClF4N2O2S — CID 119993302
N-(1-aminohexan-2-yl)-2-fluoro-5-(trifluoromethyl)benzenesulfonamide;hydrochloride (PubChem CID 119993302) has the molecular formula C13H19ClF4N2O2S and a molecular weight of 378.82 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-fluoro-5-(trifluoromethyl)benzenesulfonamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-2-fluoro-5-(trifluoromethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119993302 |
| Molecular Formula | C13H19ClF4N2O2S |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-fluoro-5-(trifluoromethyl)benzenesulfonamide;hydrochloride |
| SMILES | CCCCC(CN)NS(=O)(=O)c1cc(C(F)(F)F)ccc1F.Cl |
| InChI | InChI=1S/C13H18F4N2O2S.ClH/c1-2-3-4-10(8-18)19-22(20,21)12-7-9(13(15,16)17)5-6-11(12)14;/h5-7,10,19H,2-4,8,18H2,1H3;1H |
| InChIKey | FJWRENAIJWZLDH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |