C12H18Br2N2O2S — CID 80698004
N-(1-aminohexan-2-yl)-2,4-dibromobenzenesulfonamide (PubChem CID 80698004) has the molecular formula C12H18Br2N2O2S and a molecular weight of 414.16 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2,4-dibromobenzenesulfonamide.
| Compound Name | N-(1-aminohexan-2-yl)-2,4-dibromobenzenesulfonamide |
|---|---|
| PubChem CID | 80698004 |
| Molecular Formula | C12H18Br2N2O2S |
| Molecular Weight | 414.16 g/mol |
| Exact Mass | 411.95 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2,4-dibromobenzenesulfonamide |
| SMILES | CCCCC(CN)NS(=O)(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H18Br2N2O2S/c1-2-3-4-10(8-15)16-19(17,18)12-6-5-9(13)7-11(12)14/h5-7,10,16H,2-4,8,15H2,1H3 |
| InChIKey | PPGXGSJWGRCPDS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.16 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |