C13H23ClN2O2S — CID 119992961
N-(1-aminohexan-2-yl)-4-methylbenzenesulfonamide;hydrochloride (PubChem CID 119992961) has the molecular formula C13H23ClN2O2S and a molecular weight of 306.86 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-4-methylbenzenesulfonamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-4-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119992961 |
| Molecular Formula | C13H23ClN2O2S |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-(1-aminohexan-2-yl)-4-methylbenzenesulfonamide;hydrochloride |
| SMILES | CCCCC(CN)NS(=O)(=O)c1ccc(C)cc1.Cl |
| InChI | InChI=1S/C13H22N2O2S.ClH/c1-3-4-5-12(10-14)15-18(16,17)13-8-6-11(2)7-9-13;/h6-9,12,15H,3-5,10,14H2,1-2H3;1H |
| InChIKey | XEOGWDGDTFMGGF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |