C15H25N3O4S2 — CID 119993234
4-N-(1-aminohexan-2-yl)-1-N-cyclopropylbenzene-1,4-disulfonamide (PubChem CID 119993234) has the molecular formula C15H25N3O4S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 4-N-(1-aminohexan-2-yl)-1-N-cyclopropylbenzene-1,4-disulfonamide.
| Compound Name | 4-N-(1-aminohexan-2-yl)-1-N-cyclopropylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 119993234 |
| Molecular Formula | C15H25N3O4S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-N-(1-aminohexan-2-yl)-1-N-cyclopropylbenzene-1,4-disulfonamide |
| SMILES | CCCCC(CN)NS(=O)(=O)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C15H25N3O4S2/c1-2-3-4-13(11-16)18-24(21,22)15-9-7-14(8-10-15)23(19,20)17-12-5-6-12/h7-10,12-13,17-18H,2-6,11,16H2,1H3 |
| InChIKey | NFEFZHMTCHMXDI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |