C11H19N3O2S — CID 97225499
N-[(2S)-1-aminohexan-2-yl]pyridine-3-sulfonamide (PubChem CID 97225499) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is N-[(2S)-1-aminohexan-2-yl]pyridine-3-sulfonamide.
| Compound Name | N-[(2S)-1-aminohexan-2-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 97225499 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[(2S)-1-aminohexan-2-yl]pyridine-3-sulfonamide |
| SMILES | CCCC[C@@H](CN)NS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C11H19N3O2S/c1-2-3-5-10(8-12)14-17(15,16)11-6-4-7-13-9-11/h4,6-7,9-10,14H,2-3,5,8,12H2,1H3/t10-/m0/s1 |
| InChIKey | YHQXMRWVQVYZPT-JTQLQIEISA-N |
| XLogP | 0.88 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |