C11H19N3O2S — CID 63767546
N-(1-amino-4-methylpentan-2-yl)pyridine-3-sulfonamide (PubChem CID 63767546) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)pyridine-3-sulfonamide.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63767546 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC(C)CC(CN)NS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C11H19N3O2S/c1-9(2)6-10(7-12)14-17(15,16)11-4-3-5-13-8-11/h3-5,8-10,14H,6-7,12H2,1-2H3 |
| InChIKey | SLQZEMGUIBXIDN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |