C14H25ClN2O3S — CID 119983345
N-(1-amino-4-methylpentan-2-yl)-3-(methoxymethyl)benzenesulfonamide;hydrochloride (PubChem CID 119983345) has the molecular formula C14H25ClN2O3S and a molecular weight of 336.89 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-3-(methoxymethyl)benzenesulfonamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-3-(methoxymethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119983345 |
| Molecular Formula | C14H25ClN2O3S |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-3-(methoxymethyl)benzenesulfonamide;hydrochloride |
| SMILES | COCc1cccc(S(=O)(=O)NC(CN)CC(C)C)c1.Cl |
| InChI | InChI=1S/C14H24N2O3S.ClH/c1-11(2)7-13(9-15)16-20(17,18)14-6-4-5-12(8-14)10-19-3;/h4-6,8,11,13,16H,7,9-10,15H2,1-3H3;1H |
| InChIKey | DDMBFLXTMZKXPR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |