C13H22BrClN2O2S — CID 119983139
N-(1-amino-4-methylpentan-2-yl)-4-bromo-3-methylbenzenesulfonamide;hydrochloride (PubChem CID 119983139) has the molecular formula C13H22BrClN2O2S and a molecular weight of 385.76 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-4-bromo-3-methylbenzenesulfonamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-4-bromo-3-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119983139 |
| Molecular Formula | C13H22BrClN2O2S |
| Molecular Weight | 385.76 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-4-bromo-3-methylbenzenesulfonamide;hydrochloride |
| SMILES | Cc1cc(S(=O)(=O)NC(CN)CC(C)C)ccc1Br.Cl |
| InChI | InChI=1S/C13H21BrN2O2S.ClH/c1-9(2)6-11(8-15)16-19(17,18)12-4-5-13(14)10(3)7-12;/h4-5,7,9,11,16H,6,8,15H2,1-3H3;1H |
| InChIKey | JHPLVKVVMANLNA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.76 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |