C14H23BrN2O3S — CID 119983120
N-(1-amino-4-methylpentan-2-yl)-5-bromo-2-methoxy-4-methylbenzenesulfonamide (PubChem CID 119983120) has the molecular formula C14H23BrN2O3S and a molecular weight of 379.32 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-5-bromo-2-methoxy-4-methylbenzenesulfonamide.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-5-bromo-2-methoxy-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 119983120 |
| Molecular Formula | C14H23BrN2O3S |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-5-bromo-2-methoxy-4-methylbenzenesulfonamide |
| SMILES | COc1cc(C)c(Br)cc1S(=O)(=O)NC(CN)CC(C)C |
| InChI | InChI=1S/C14H23BrN2O3S/c1-9(2)5-11(8-16)17-21(18,19)14-7-12(15)10(3)6-13(14)20-4/h6-7,9,11,17H,5,8,16H2,1-4H3 |
| InChIKey | DHVQTYCFINCDJU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |