C12H19BrN2O3S — CID 119972422
N-(3-aminobutyl)-5-bromo-2-methoxy-4-methylbenzenesulfonamide (PubChem CID 119972422) has the molecular formula C12H19BrN2O3S and a molecular weight of 351.27 g/mol. Its IUPAC name is N-(3-aminobutyl)-5-bromo-2-methoxy-4-methylbenzenesulfonamide.
| Compound Name | N-(3-aminobutyl)-5-bromo-2-methoxy-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 119972422 |
| Molecular Formula | C12H19BrN2O3S |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | N-(3-aminobutyl)-5-bromo-2-methoxy-4-methylbenzenesulfonamide |
| SMILES | COc1cc(C)c(Br)cc1S(=O)(=O)NCCC(C)N |
| InChI | InChI=1S/C12H19BrN2O3S/c1-8-6-11(18-3)12(7-10(8)13)19(16,17)15-5-4-9(2)14/h6-7,9,15H,4-5,14H2,1-3H3 |
| InChIKey | JKRUUZPWPOCTOI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |