C12H19BrN2O4S — CID 119972818
N-(3-aminobutyl)-5-bromo-2,4-dimethoxybenzenesulfonamide (PubChem CID 119972818) has the molecular formula C12H19BrN2O4S and a molecular weight of 367.27 g/mol. Its IUPAC name is N-(3-aminobutyl)-5-bromo-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(3-aminobutyl)-5-bromo-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 119972818 |
| Molecular Formula | C12H19BrN2O4S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | N-(3-aminobutyl)-5-bromo-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1cc(OC)c(S(=O)(=O)NCCC(C)N)cc1Br |
| InChI | InChI=1S/C12H19BrN2O4S/c1-8(14)4-5-15-20(16,17)12-6-9(13)10(18-2)7-11(12)19-3/h6-8,15H,4-5,14H2,1-3H3 |
| InChIKey | YXUGMYWYDNLLKN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |