C11H16BrClN2O3S — CID 119972697
N-(3-aminobutyl)-2-bromo-5-chloro-4-methoxybenzenesulfonamide (PubChem CID 119972697) has the molecular formula C11H16BrClN2O3S and a molecular weight of 371.68 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-bromo-5-chloro-4-methoxybenzenesulfonamide.
| Compound Name | N-(3-aminobutyl)-2-bromo-5-chloro-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 119972697 |
| Molecular Formula | C11H16BrClN2O3S |
| Molecular Weight | 371.68 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | N-(3-aminobutyl)-2-bromo-5-chloro-4-methoxybenzenesulfonamide |
| SMILES | COc1cc(Br)c(S(=O)(=O)NCCC(C)N)cc1Cl |
| InChI | InChI=1S/C11H16BrClN2O3S/c1-7(14)3-4-15-19(16,17)11-6-9(13)10(18-2)5-8(11)12/h5-7,15H,3-4,14H2,1-2H3 |
| InChIKey | CGLXKRYCDGZGAS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.68 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |